C26H23NO6 — CID 71584028
3-[3-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanoylamino]benzoic acid (PubChem CID 71584028) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is 3-[3-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanoylamino]benzoic acid.
| Compound Name | 3-[3-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 71584028 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3-[3-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanoylamino]benzoic acid |
| SMILES | Cc1c(CCC(=O)Nc2cccc(C(=O)O)c2)c(=O)oc2cc3oc4c(c3cc12)CCCC4 |
| InChI | InChI=1S/C26H23NO6/c1-14-17(9-10-24(28)27-16-6-4-5-15(11-16)25(29)30)26(31)33-22-13-23-20(12-19(14)22)18-7-2-3-8-21(18)32-23/h4-6,11-13H,2-3,7-10H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | LTTVGFZHAGJRQR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|