C22H21NO6 — CID 6237174
ethyl 3-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoylamino]benzoate (PubChem CID 6237174) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is ethyl 3-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoylamino]benzoate.
| Compound Name | ethyl 3-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 6237174 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | ethyl 3-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CCc2c(C)c3ccc(O)cc3oc2=O)c1 |
| InChI | InChI=1S/C22H21NO6/c1-3-28-21(26)14-5-4-6-15(11-14)23-20(25)10-9-18-13(2)17-8-7-16(24)12-19(17)29-22(18)27/h4-8,11-12,24H,3,9-10H2,1-2H3,(H,23,25) |
| InChIKey | KIOFESMAHSCTMF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|