C19H15F2NO4 — CID 6236717
N-(2,4-difluorophenyl)-3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanamide (PubChem CID 6236717) has the molecular formula C19H15F2NO4 and a molecular weight of 359.33 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-(2,4-difluorophenyl)-3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 6236717 |
| Molecular Formula | C19H15F2NO4 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanamide |
| SMILES | Cc1c(CCC(=O)Nc2ccc(F)cc2F)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C19H15F2NO4/c1-10-13-4-3-12(23)9-17(13)26-19(25)14(10)5-7-18(24)22-16-6-2-11(20)8-15(16)21/h2-4,6,8-9,23H,5,7H2,1H3,(H,22,24) |
| InChIKey | FBNCHTGWMMVORM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|