C23H23NO6S — CID 6851200
(2R)-3-benzylsulfanyl-2-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoylamino]propanoic acid (PubChem CID 6851200) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is (2R)-3-benzylsulfanyl-2-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoylamino]propanoic acid.
| Compound Name | (2R)-3-benzylsulfanyl-2-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 6851200 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (2R)-3-benzylsulfanyl-2-[3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)propanoylamino]propanoic acid |
| SMILES | Cc1c(CCC(=O)N[C@@H](CSCc2ccccc2)C(=O)O)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C23H23NO6S/c1-14-17-8-7-16(25)11-20(17)30-23(29)18(14)9-10-21(26)24-19(22(27)28)13-31-12-15-5-3-2-4-6-15/h2-8,11,19,25H,9-10,12-13H2,1H3,(H,24,26)(H,27,28)/t19-/m0/s1 |
| InChIKey | DHRLAKWEJWTYGV-IBGZPJMESA-N |
| XLogP | 3.24 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|