C32H36N2O7S — CID 73399849
3-benzylsulfanyl-2-[2-[3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]pentanoylamino]propanoic acid (PubChem CID 73399849) has the molecular formula C32H36N2O7S and a molecular weight of 592.71 g/mol. Its IUPAC name is 3-benzylsulfanyl-2-[2-[3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]pentanoylamino]propanoic acid.
| Compound Name | 3-benzylsulfanyl-2-[2-[3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]pentanoylamino]propanoic acid |
|---|---|
| PubChem CID | 73399849 |
| Molecular Formula | C32H36N2O7S |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | 3-benzylsulfanyl-2-[2-[3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]pentanoylamino]propanoic acid |
| SMILES | CCCC(NC(=O)CCc1c(C)c2cc3c(C)coc3c(C)c2oc1=O)C(=O)NC(CSCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C32H36N2O7S/c1-5-9-25(30(36)34-26(31(37)38)17-42-16-21-10-7-6-8-11-21)33-27(35)13-12-22-19(3)24-14-23-18(2)15-40-28(23)20(4)29(24)41-32(22)39/h6-8,10-11,14-15,25-26H,5,9,12-13,16-17H2,1-4H3,(H,33,35)(H,34,36)(H,37,38) |
| InChIKey | HLOACRWXXKVBNR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|