C27H27NO6S — CID 3518791
3-benzylsulfanyl-2-[[2-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]propanoic acid (PubChem CID 3518791) has the molecular formula C27H27NO6S and a molecular weight of 493.58 g/mol. Its IUPAC name is 3-benzylsulfanyl-2-[[2-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-benzylsulfanyl-2-[[2-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 3518791 |
| Molecular Formula | C27H27NO6S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 3-benzylsulfanyl-2-[[2-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]propanoic acid |
| SMILES | Cc1oc2c(C)c3oc(=O)c(CC(=O)NC(CSCc4ccccc4)C(=O)O)c(C)c3cc2c1C |
| InChI | InChI=1S/C27H27NO6S/c1-14-17(4)33-24-16(3)25-20(10-19(14)24)15(2)21(27(32)34-25)11-23(29)28-22(26(30)31)13-35-12-18-8-6-5-7-9-18/h5-10,22H,11-13H2,1-4H3,(H,28,29)(H,30,31) |
| InChIKey | MNXHZTOHIHAFKG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|