C26H25NO6 — CID 73256609
3-phenyl-2-[[2-(2,3,4,9-tetramethyl-7-oxofuro[2,3-f]chromen-8-yl)acetyl]amino]propanoic acid (PubChem CID 73256609) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is 3-phenyl-2-[[2-(2,3,4,9-tetramethyl-7-oxofuro[2,3-f]chromen-8-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-phenyl-2-[[2-(2,3,4,9-tetramethyl-7-oxofuro[2,3-f]chromen-8-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 73256609 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3-phenyl-2-[[2-(2,3,4,9-tetramethyl-7-oxofuro[2,3-f]chromen-8-yl)acetyl]amino]propanoic acid |
| SMILES | Cc1oc2c(c(C)cc3oc(=O)c(CC(=O)NC(Cc4ccccc4)C(=O)O)c(C)c32)c1C |
| InChI | InChI=1S/C26H25NO6/c1-13-10-20-23(24-22(13)14(2)16(4)32-24)15(3)18(26(31)33-20)12-21(28)27-19(25(29)30)11-17-8-6-5-7-9-17/h5-10,19H,11-12H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | MZPCEUUKQJAFTG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|