C26H25NO6 — CID 3848769
3-phenyl-2-[3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]propanoic acid (PubChem CID 3848769) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is 3-phenyl-2-[3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]propanoic acid.
| Compound Name | 3-phenyl-2-[3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 3848769 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3-phenyl-2-[3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]propanoic acid |
| SMILES | Cc1oc2cc3oc(=O)c(CCC(=O)NC(Cc4ccccc4)C(=O)O)c(C)c3cc2c1C |
| InChI | InChI=1S/C26H25NO6/c1-14-16(3)32-22-13-23-20(12-19(14)22)15(2)18(26(31)33-23)9-10-24(28)27-21(25(29)30)11-17-7-5-4-6-8-17/h4-8,12-13,21H,9-11H2,1-3H3,(H,27,28)(H,29,30) |
| InChIKey | DDZVSEBJMLNSAQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|