C22H25NO7S — CID 28923826
(2S)-4-[(R)-methylsulfinyl]-2-[3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]butanoic acid (PubChem CID 28923826) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is (2S)-4-[(R)-methylsulfinyl]-2-[3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]butanoic acid.
| Compound Name | (2S)-4-[(R)-methylsulfinyl]-2-[3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 28923826 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (2S)-4-[(R)-methylsulfinyl]-2-[3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]butanoic acid |
| SMILES | Cc1oc2cc3oc(=O)c(CCC(=O)N[C@@H](CC[S@@](C)=O)C(=O)O)c(C)c3cc2c1C |
| InChI | InChI=1S/C22H25NO7S/c1-11-13(3)29-18-10-19-16(9-15(11)18)12(2)14(22(27)30-19)5-6-20(24)23-17(21(25)26)7-8-31(4)28/h9-10,17H,5-8H2,1-4H3,(H,23,24)(H,25,26)/t17-,31+/m0/s1 |
| InChIKey | VYOSUBZIMCLPMT-NMEJYPJZSA-N |
| XLogP | 2.74 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|