C20H21NO7S — CID 11862591
(2R)-2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]-4-[(S)-methylsulfinyl]butanoic acid (PubChem CID 11862591) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is (2R)-2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]-4-[(S)-methylsulfinyl]butanoic acid.
| Compound Name | (2R)-2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]-4-[(S)-methylsulfinyl]butanoic acid |
|---|---|
| PubChem CID | 11862591 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | (2R)-2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]-4-[(S)-methylsulfinyl]butanoic acid |
| SMILES | Cc1coc2cc3oc(=O)c(CC(=O)N[C@H](CC[S@](C)=O)C(=O)O)c(C)c3cc12 |
| InChI | InChI=1S/C20H21NO7S/c1-10-9-27-16-8-17-13(6-12(10)16)11(2)14(20(25)28-17)7-18(22)21-15(19(23)24)4-5-29(3)26/h6,8-9,15H,4-5,7H2,1-3H3,(H,21,22)(H,23,24)/t15-,29+/m1/s1 |
| InChIKey | VRINVXPZWWHUEC-HOLBHBGLSA-N |
| XLogP | 2.04 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|