C18H19NO6 — CID 40854906
N-[(2S)-2,3-dihydroxypropyl]-2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide (PubChem CID 40854906) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is N-[(2S)-2,3-dihydroxypropyl]-2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide.
| Compound Name | N-[(2S)-2,3-dihydroxypropyl]-2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide |
|---|---|
| PubChem CID | 40854906 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[(2S)-2,3-dihydroxypropyl]-2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide |
| SMILES | Cc1coc2cc3oc(=O)c(CC(=O)NC[C@H](O)CO)c(C)c3cc12 |
| InChI | InChI=1S/C18H19NO6/c1-9-8-24-15-5-16-13(3-12(9)15)10(2)14(18(23)25-16)4-17(22)19-6-11(21)7-20/h3,5,8,11,20-21H,4,6-7H2,1-2H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | FIHDTINUMCECJV-NSHDSACASA-N |
| XLogP | 1.17 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|