C22H18N2O5 — CID 4869567
2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]benzamide (PubChem CID 4869567) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]benzamide.
| Compound Name | 2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 4869567 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]benzamide |
| SMILES | Cc1coc2cc3oc(=O)c(CC(=O)Nc4ccccc4C(N)=O)c(C)c3cc12 |
| InChI | InChI=1S/C22H18N2O5/c1-11-10-28-18-9-19-15(7-14(11)18)12(2)16(22(27)29-19)8-20(25)24-17-6-4-3-5-13(17)21(23)26/h3-7,9-10H,8H2,1-2H3,(H2,23,26)(H,24,25) |
| InChIKey | OFKSYGBXGPINCW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|