C21H23NO6S — CID 3721770
2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]-4-ethylsulfanylbutanoic acid (PubChem CID 3721770) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]-4-ethylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 3721770 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCCC(NC(=O)Cc1c(C)c2cc3c(C)coc3cc2oc1=O)C(=O)O |
| InChI | InChI=1S/C21H23NO6S/c1-4-29-6-5-16(20(24)25)22-19(23)8-15-12(3)14-7-13-11(2)10-27-17(13)9-18(14)28-21(15)26/h7,9-10,16H,4-6,8H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | VHATXJKTYVRTBY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|