C21H23NO6 — CID 6851181
(2S)-2-[3-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]propanoic acid (PubChem CID 6851181) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2S)-2-[3-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]propanoic acid.
| Compound Name | (2S)-2-[3-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 6851181 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (2S)-2-[3-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]propanoic acid |
| SMILES | Cc1oc2c(C)c3oc(=O)c(CCC(=O)N[C@@H](C)C(=O)O)c(C)c3cc2c1C |
| InChI | InChI=1S/C21H23NO6/c1-9-13(5)27-18-11(3)19-16(8-15(9)18)10(2)14(21(26)28-19)6-7-17(23)22-12(4)20(24)25/h8,12H,6-7H2,1-5H3,(H,22,23)(H,24,25)/t12-/m0/s1 |
| InChIKey | DKQWZWFPKLPPNN-LBPRGKRZSA-N |
| XLogP | 3.29 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|