C25H24FNO4 — CID 23606081
N-[(4-fluorophenyl)methyl]-3-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide (PubChem CID 23606081) has the molecular formula C25H24FNO4 and a molecular weight of 421.47 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide |
|---|---|
| PubChem CID | 23606081 |
| Molecular Formula | C25H24FNO4 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide |
| SMILES | Cc1oc2c(C)c3oc(=O)c(CCC(=O)NCc4ccc(F)cc4)c(C)c3cc2c1C |
| InChI | InChI=1S/C25H24FNO4/c1-13-16(4)30-23-15(3)24-21(11-20(13)23)14(2)19(25(29)31-24)9-10-22(28)27-12-17-5-7-18(26)8-6-17/h5-8,11H,9-10,12H2,1-4H3,(H,27,28) |
| InChIKey | UIQCLJKMFUPKIV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|