C20H18FNO4 — CID 6225547
N-(4-fluorophenyl)-3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanamide (PubChem CID 6225547) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-(4-fluorophenyl)-3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 6225547 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-(4-fluorophenyl)-3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanamide |
| SMILES | Cc1c(CCC(=O)Nc2ccc(F)cc2)c(=O)oc2c(C)c(O)ccc12 |
| InChI | InChI=1S/C20H18FNO4/c1-11-15-7-9-17(23)12(2)19(15)26-20(25)16(11)8-10-18(24)22-14-5-3-13(21)4-6-14/h3-7,9,23H,8,10H2,1-2H3,(H,22,24) |
| InChIKey | WZDYTRLTUVFROI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|