C20H25NO6 — CID 6351665
(2S,3R)-2-[3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanoylamino]-3-methylpentanoic acid (PubChem CID 6351665) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is (2S,3R)-2-[3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanoylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 6351665 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2S,3R)-2-[3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanoylamino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NC(=O)CCc1c(C)c2ccc(O)c(C)c2oc1=O)C(=O)O |
| InChI | InChI=1S/C20H25NO6/c1-5-10(2)17(19(24)25)21-16(23)9-7-14-11(3)13-6-8-15(22)12(4)18(13)27-20(14)26/h6,8,10,17,22H,5,7,9H2,1-4H3,(H,21,23)(H,24,25)/t10-,17+/m1/s1 |
| InChIKey | BMUZWICCRQHOTG-QGHHPUGFSA-N |
| XLogP | 2.66 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|