C22H23NO5 — CID 40825668
3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[(2S)-2-hydroxy-2-phenylethyl]propanamide (PubChem CID 40825668) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[(2S)-2-hydroxy-2-phenylethyl]propanamide.
| Compound Name | 3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[(2S)-2-hydroxy-2-phenylethyl]propanamide |
|---|---|
| PubChem CID | 40825668 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[(2S)-2-hydroxy-2-phenylethyl]propanamide |
| SMILES | Cc1c(CCC(=O)NC[C@@H](O)c2ccccc2)c(=O)oc2c(C)c(O)ccc12 |
| InChI | InChI=1S/C22H23NO5/c1-13-16-8-10-18(24)14(2)21(16)28-22(27)17(13)9-11-20(26)23-12-19(25)15-6-4-3-5-7-15/h3-8,10,19,24-25H,9,11-12H2,1-2H3,(H,23,26)/t19-/m1/s1 |
| InChIKey | HIBBMGNMHQITIE-LJQANCHMSA-N |
| XLogP | 2.90 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|