C21H19NO6 — CID 6569377
(2S)-2-[[2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)acetyl]amino]-2-phenylacetic acid (PubChem CID 6569377) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is (2S)-2-[[2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 6569377 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (2S)-2-[[2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)acetyl]amino]-2-phenylacetic acid |
| SMILES | Cc1c(CC(=O)N[C@H](C(=O)O)c2ccccc2)c(=O)oc2c(C)c(O)ccc12 |
| InChI | InChI=1S/C21H19NO6/c1-11-14-8-9-16(23)12(2)19(14)28-21(27)15(11)10-17(24)22-18(20(25)26)13-6-4-3-5-7-13/h3-9,18,23H,10H2,1-2H3,(H,22,24)(H,25,26)/t18-/m0/s1 |
| InChIKey | ZGWLUQXBQKFZEQ-SFHVURJKSA-N |
| XLogP | 2.60 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|