C28H20FNO6 — CID 6352026
(2R)-2-[[2-[3-(4-fluorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]-2-phenylacetic acid (PubChem CID 6352026) has the molecular formula C28H20FNO6 and a molecular weight of 485.47 g/mol. Its IUPAC name is (2R)-2-[[2-[3-(4-fluorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[2-[3-(4-fluorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 6352026 |
| Molecular Formula | C28H20FNO6 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (2R)-2-[[2-[3-(4-fluorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]acetyl]amino]-2-phenylacetic acid |
| SMILES | Cc1c(CC(=O)N[C@@H](C(=O)O)c2ccccc2)c(=O)oc2cc3occ(-c4ccc(F)cc4)c3cc12 |
| InChI | InChI=1S/C28H20FNO6/c1-15-19-11-21-22(16-7-9-18(29)10-8-16)14-35-23(21)13-24(19)36-28(34)20(15)12-25(31)30-26(27(32)33)17-5-3-2-4-6-17/h2-11,13-14,26H,12H2,1H3,(H,30,31)(H,32,33)/t26-/m1/s1 |
| InChIKey | NCWFQQVPYDRYAY-AREMUKBSSA-N |
| XLogP | 5.14 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|