C24H23NO5 — CID 4967700
N-(3-methoxypropyl)-2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetamide (PubChem CID 4967700) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetamide.
| Compound Name | N-(3-methoxypropyl)-2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetamide |
|---|---|
| PubChem CID | 4967700 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-(3-methoxypropyl)-2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetamide |
| SMILES | COCCCNC(=O)Cc1c(C)c2cc3c(-c4ccccc4)coc3cc2oc1=O |
| InChI | InChI=1S/C24H23NO5/c1-15-17-11-19-20(16-7-4-3-5-8-16)14-29-21(19)13-22(17)30-24(27)18(15)12-23(26)25-9-6-10-28-2/h3-5,7-8,11,13-14H,6,9-10,12H2,1-2H3,(H,25,26) |
| InChIKey | SVQYDDPWPIIJED-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|