C32H36N2O7 — CID 73255936
6-[[3-methyl-2-[3-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]butanoyl]amino]hexanoic acid (PubChem CID 73255936) has the molecular formula C32H36N2O7 and a molecular weight of 560.65 g/mol. Its IUPAC name is 6-[[3-methyl-2-[3-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]butanoyl]amino]hexanoic acid.
| Compound Name | 6-[[3-methyl-2-[3-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 73255936 |
| Molecular Formula | C32H36N2O7 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 6-[[3-methyl-2-[3-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]butanoyl]amino]hexanoic acid |
| SMILES | Cc1c(CCC(=O)NC(C(=O)NCCCCCC(=O)O)C(C)C)c(=O)oc2cc3occ(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C32H36N2O7/c1-19(2)30(31(38)33-15-9-5-8-12-29(36)37)34-28(35)14-13-22-20(3)23-16-24-25(21-10-6-4-7-11-21)18-40-26(24)17-27(23)41-32(22)39/h4,6-7,10-11,16-19,30H,5,8-9,12-15H2,1-3H3,(H,33,38)(H,34,35)(H,36,37) |
| InChIKey | RTJKUAZYTNNNMS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|