C35H34N2O7 — CID 73256145
2-[6-[[2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]hexanoylamino]-3-phenylpropanoic acid (PubChem CID 73256145) has the molecular formula C35H34N2O7 and a molecular weight of 594.66 g/mol. Its IUPAC name is 2-[6-[[2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]hexanoylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[6-[[2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]hexanoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 73256145 |
| Molecular Formula | C35H34N2O7 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | 2-[6-[[2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]hexanoylamino]-3-phenylpropanoic acid |
| SMILES | Cc1c(CC(=O)NCCCCCC(=O)NC(Cc2ccccc2)C(=O)O)c(=O)oc2cc3occ(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C35H34N2O7/c1-22-25-18-27-28(24-13-7-3-8-14-24)21-43-30(27)20-31(25)44-35(42)26(22)19-33(39)36-16-10-4-9-15-32(38)37-29(34(40)41)17-23-11-5-2-6-12-23/h2-3,5-8,11-14,18,20-21,29H,4,9-10,15-17,19H2,1H3,(H,36,39)(H,37,38)(H,40,41) |
| InChIKey | NUSJHZKUBMZLMH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|