C23H20ClNO5 — CID 4974497
2-[3-(4-chlorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 4974497) has the molecular formula C23H20ClNO5 and a molecular weight of 425.87 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 4974497 |
| Molecular Formula | C23H20ClNO5 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cc1c(C)c2cc3c(-c4ccc(Cl)cc4)coc3cc2oc1=O |
| InChI | InChI=1S/C23H20ClNO5/c1-13-16-9-18-19(14-3-5-15(24)6-4-14)12-29-20(18)11-21(16)30-23(27)17(13)10-22(26)25-7-8-28-2/h3-6,9,11-12H,7-8,10H2,1-2H3,(H,25,26) |
| InChIKey | PSSDXLCJBUBVHB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|