C23H20FNO4 — CID 4900801
2-[3-(4-fluorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-propan-2-ylacetamide (PubChem CID 4900801) has the molecular formula C23H20FNO4 and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[3-(4-fluorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 4900801 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-propan-2-ylacetamide |
| SMILES | Cc1c(CC(=O)NC(C)C)c(=O)oc2cc3occ(-c4ccc(F)cc4)c3cc12 |
| InChI | InChI=1S/C23H20FNO4/c1-12(2)25-22(26)9-17-13(3)16-8-18-19(14-4-6-15(24)7-5-14)11-28-20(18)10-21(16)29-23(17)27/h4-8,10-12H,9H2,1-3H3,(H,25,26) |
| InChIKey | LOUQTSJPNWOCHJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|