C32H28N2O7S — CID 73400133
2-[[3-benzylsulfanyl-2-[[2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]propanoyl]amino]acetic acid (PubChem CID 73400133) has the molecular formula C32H28N2O7S and a molecular weight of 584.65 g/mol. Its IUPAC name is 2-[[3-benzylsulfanyl-2-[[2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]propanoyl]amino]acetic acid.
| Compound Name | 2-[[3-benzylsulfanyl-2-[[2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 73400133 |
| Molecular Formula | C32H28N2O7S |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 2-[[3-benzylsulfanyl-2-[[2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]amino]propanoyl]amino]acetic acid |
| SMILES | Cc1c(CC(=O)NC(CSCc2ccccc2)C(=O)NCC(=O)O)c(=O)oc2cc3occ(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C32H28N2O7S/c1-19-22-12-24-25(21-10-6-3-7-11-21)16-40-27(24)14-28(22)41-32(39)23(19)13-29(35)34-26(31(38)33-15-30(36)37)18-42-17-20-8-4-2-5-9-20/h2-12,14,16,26H,13,15,17-18H2,1H3,(H,33,38)(H,34,35)(H,36,37) |
| InChIKey | RMXDFZIYNFTYOS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|