C24H19NO6S — CID 40961301
N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetamide (PubChem CID 40961301) has the molecular formula C24H19NO6S and a molecular weight of 449.48 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetamide.
| Compound Name | N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetamide |
|---|---|
| PubChem CID | 40961301 |
| Molecular Formula | C24H19NO6S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetamide |
| SMILES | Cc1c(CC(=O)N[C@@H]2C=CS(=O)(=O)C2)c(=O)oc2cc3occ(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C24H19NO6S/c1-14-17-9-19-20(15-5-3-2-4-6-15)12-30-21(19)11-22(17)31-24(27)18(14)10-23(26)25-16-7-8-32(28,29)13-16/h2-9,11-12,16H,10,13H2,1H3,(H,25,26)/t16-/m1/s1 |
| InChIKey | HLDOCIXQJOLLFR-MRXNPFEDSA-N |
| XLogP | 3.48 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|