C23H23NO6S — CID 41009923
N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanamide (PubChem CID 41009923) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanamide.
| Compound Name | N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanamide |
|---|---|
| PubChem CID | 41009923 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)propanamide |
| SMILES | Cc1c(CCC(=O)N[C@@H]2C=CS(=O)(=O)C2)c(=O)oc2cc3oc4c(c3cc12)CCCC4 |
| InChI | InChI=1S/C23H23NO6S/c1-13-15(6-7-22(25)24-14-8-9-31(27,28)12-14)23(26)30-20-11-21-18(10-17(13)20)16-4-2-3-5-19(16)29-21/h8-11,14H,2-7,12H2,1H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | UTOAMLWKNVQOFY-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|