C21H23NO7S — CID 40816550
N-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide (PubChem CID 40816550) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide.
| Compound Name | N-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide |
|---|---|
| PubChem CID | 40816550 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-3-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide |
| SMILES | Cc1oc2cc3oc(=O)c(CCC(=O)N[C@H]4CS(=O)(=O)C[C@@H]4O)c(C)c3cc2c1C |
| InChI | InChI=1S/C21H23NO7S/c1-10-12(3)28-18-7-19-15(6-14(10)18)11(2)13(21(25)29-19)4-5-20(24)22-16-8-30(26,27)9-17(16)23/h6-7,16-17,23H,4-5,8-9H2,1-3H3,(H,22,24)/t16-,17-/m0/s1 |
| InChIKey | CWLPYTGPRICPQL-IRXDYDNUSA-N |
| XLogP | 1.67 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|