C18H21NO8S — CID 41025248
2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 41025248) has the molecular formula C18H21NO8S and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 41025248 |
| Molecular Formula | C18H21NO8S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | COc1ccc2c(C)c(CC(=O)N[C@@H]3CS(=O)(=O)C[C@H]3O)c(=O)oc2c1OC |
| InChI | InChI=1S/C18H21NO8S/c1-9-10-4-5-14(25-2)17(26-3)16(10)27-18(22)11(9)6-15(21)19-12-7-28(23,24)8-13(12)20/h4-5,12-13,20H,6-8H2,1-3H3,(H,19,21)/t12-,13-/m1/s1 |
| InChIKey | FKEJVZPRDGLHMI-CHWSQXEVSA-N |
| XLogP | -0.06 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|