C20H17Cl2NO5 — CID 4871526
N-(2,3-dichlorophenyl)-2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)acetamide (PubChem CID 4871526) has the molecular formula C20H17Cl2NO5 and a molecular weight of 422.26 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 4871526 |
| Molecular Formula | C20H17Cl2NO5 |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)acetamide |
| SMILES | COc1ccc2c(C)c(CC(=O)Nc3cccc(Cl)c3Cl)c(=O)oc2c1OC |
| InChI | InChI=1S/C20H17Cl2NO5/c1-10-11-7-8-15(26-2)19(27-3)18(11)28-20(25)12(10)9-16(24)23-14-6-4-5-13(21)17(14)22/h4-8H,9H2,1-3H3,(H,23,24) |
| InChIKey | CEYVBSXAOCKPQG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|