C24H24N2O5 — CID 56723679
2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-(2-indol-1-ylethyl)acetamide (PubChem CID 56723679) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-(2-indol-1-ylethyl)acetamide.
| Compound Name | 2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-(2-indol-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 56723679 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-(2-indol-1-ylethyl)acetamide |
| SMILES | COc1ccc2c(C)c(CC(=O)NCCn3ccc4ccccc43)c(=O)oc2c1OC |
| InChI | InChI=1S/C24H24N2O5/c1-15-17-8-9-20(29-2)23(30-3)22(17)31-24(28)18(15)14-21(27)25-11-13-26-12-10-16-6-4-5-7-19(16)26/h4-10,12H,11,13-14H2,1-3H3,(H,25,27) |
| InChIKey | PBOYEERBXONTNE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|