C20H26N2O5 — CID 4974013
2-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 4974013) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 4974013 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | COc1ccc2c(C)c(CC(=O)NCCN3CCOCC3)c(=O)oc2c1C |
| InChI | InChI=1S/C20H26N2O5/c1-13-15-4-5-17(25-3)14(2)19(15)27-20(24)16(13)12-18(23)21-6-7-22-8-10-26-11-9-22/h4-5H,6-12H2,1-3H3,(H,21,23) |
| InChIKey | BRUJJKJVRAURMR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|