C18H22N2O6 — CID 6225544
2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 6225544) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 6225544 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | Cc1c(CC(=O)NCCN2CCOCC2)c(=O)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C18H22N2O6/c1-11-13(10-16(23)19-2-3-20-4-6-25-7-5-20)18(24)26-15-9-12(21)8-14(22)17(11)15/h8-9,21-22H,2-7,10H2,1H3,(H,19,23) |
| InChIKey | HXNCFMDGHIDAIH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|