C16H19NO5 — CID 6221816
2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(2-methylpropyl)acetamide (PubChem CID 6221816) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(2-methylpropyl)acetamide.
| Compound Name | 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 6221816 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(2-methylpropyl)acetamide |
| SMILES | Cc1c(CC(=O)NCC(C)C)c(=O)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C16H19NO5/c1-8(2)7-17-14(20)6-11-9(3)15-12(19)4-10(18)5-13(15)22-16(11)21/h4-5,8,18-19H,6-7H2,1-3H3,(H,17,20) |
| InChIKey | QCTVJEPDQFMELH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|