About N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide
N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide (PubChem CID 6221952) has the molecular formula C16H19NO5
and a molecular weight of 305.33 g/mol. Its IUPAC name is N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide.
Molecular Properties
| Compound Name | N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
| PubChem CID | 6221952 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
| SMILES | CCC(C)NC(=O)Cc1c(C)c2c(O)cc(O)cc2oc1=O |
| InChI | InChI=1S/C16H19NO5/c1-4-8(2)17-14(20)7-11-9(3)15-12(19)5-10(18)6-13(15)22-16(11)21/h5-6,8,18-19H,4,7H2,1-3H3,(H,17,20) |
| InChIKey | HTWNYUQJPLDNLX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide?
The IUPAC name of N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide (CID 6221952) is N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide.
What is the SMILES notation for N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide?
The canonical SMILES for N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide is CCC(C)NC(=O)Cc1c(C)c2c(O)cc(O)cc2oc1=O.
What is the InChIKey of N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide?
The InChIKey is HTWNYUQJPLDNLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO5/c1-4-8(2)17-14(20)7-11-9(3)15-12(19)5-10(18)6-13(15)22-16(11)21/h5-6,8,18-19H,4,7H2,1-3H3,(H,17,20).
What are the key properties of N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide?
N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide has a molecular weight of 305.33 g/mol, XLogP of 1.97, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide is sourced from PubChem (CID 6221952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).