C19H16ClNO5 — CID 6237529
N-(3-chloro-2-methylphenyl)-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide (PubChem CID 6237529) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 6237529 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)Cc1c(C)c2c(O)cc(O)cc2oc1=O |
| InChI | InChI=1S/C19H16ClNO5/c1-9-12(8-17(24)21-14-5-3-4-13(20)10(14)2)19(25)26-16-7-11(22)6-15(23)18(9)16/h3-7,22-23H,8H2,1-2H3,(H,21,24) |
| InChIKey | KAXDMUYUGNOYSY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|