C18H14ClNO5 — CID 6236971
N-(2-chlorophenyl)-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide (PubChem CID 6236971) has the molecular formula C18H14ClNO5 and a molecular weight of 359.77 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 6236971 |
| Molecular Formula | C18H14ClNO5 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(2-chlorophenyl)-2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
| SMILES | Cc1c(CC(=O)Nc2ccccc2Cl)c(=O)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C18H14ClNO5/c1-9-11(8-16(23)20-13-5-3-2-4-12(13)19)18(24)25-15-7-10(21)6-14(22)17(9)15/h2-7,21-22H,8H2,1H3,(H,20,23) |
| InChIKey | ILEKUTHYOKVLHI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|