C20H16F3NO5 — CID 6226280
2-(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 6226280) has the molecular formula C20H16F3NO5 and a molecular weight of 407.34 g/mol. Its IUPAC name is 2-(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 6226280 |
| Molecular Formula | C20H16F3NO5 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | Cc1cc(O)c2c(C)c(CC(=O)Nc3ccc(OC(F)(F)F)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H16F3NO5/c1-10-7-15(25)18-11(2)14(19(27)28-16(18)8-10)9-17(26)24-12-3-5-13(6-4-12)29-20(21,22)23/h3-8,25H,9H2,1-2H3,(H,24,26) |
| InChIKey | UUKFCHPVZYKIBC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|