C21H18F3NO5 — CID 4971234
2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 4971234) has the molecular formula C21H18F3NO5 and a molecular weight of 421.37 g/mol. Its IUPAC name is 2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 4971234 |
| Molecular Formula | C21H18F3NO5 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COc1cc(C)cc2oc(=O)c(CC(=O)Nc3ccc(OC(F)(F)F)cc3)c(C)c12 |
| InChI | InChI=1S/C21H18F3NO5/c1-11-8-16(28-3)19-12(2)15(20(27)29-17(19)9-11)10-18(26)25-13-4-6-14(7-5-13)30-21(22,23)24/h4-9H,10H2,1-3H3,(H,25,26) |
| InChIKey | NVIXANWPNNNUNK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|