C20H18FNO5 — CID 4971132
2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 4971132) has the molecular formula C20H18FNO5 and a molecular weight of 371.36 g/mol. Its IUPAC name is 2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4971132 |
| Molecular Formula | C20H18FNO5 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(OC)c2c(C)c(CC(=O)Nc3ccc(F)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H18FNO5/c1-11-15(10-18(23)22-13-6-4-12(21)5-7-13)20(24)27-17-9-14(25-2)8-16(26-3)19(11)17/h4-9H,10H2,1-3H3,(H,22,23) |
| InChIKey | ZSBNKXOKPWGRMF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|