C19H23NO7 — CID 3791578
2-[[2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-methylbutanoic acid (PubChem CID 3791578) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-[[2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 3791578 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[[2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-methylbutanoic acid |
| SMILES | COc1cc(OC)c2c(C)c(CC(=O)NC(C(=O)O)C(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C19H23NO7/c1-9(2)17(18(22)23)20-15(21)8-12-10(3)16-13(26-5)6-11(25-4)7-14(16)27-19(12)24/h6-7,9,17H,8H2,1-5H3,(H,20,21)(H,22,23) |
| InChIKey | GHNNUFODVVVLKM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|