C19H23NO6 — CID 6352141
(2S,3R)-2-[[2-(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)acetyl]amino]-3-methylpentanoic acid (PubChem CID 6352141) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is (2S,3R)-2-[[2-(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)acetyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[[2-(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 6352141 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (2S,3R)-2-[[2-(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)acetyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NC(=O)Cc1c(C)c2c(O)cc(C)cc2oc1=O)C(=O)O |
| InChI | InChI=1S/C19H23NO6/c1-5-10(3)17(18(23)24)20-15(22)8-12-11(4)16-13(21)6-9(2)7-14(16)26-19(12)25/h6-7,10,17,21H,5,8H2,1-4H3,(H,20,22)(H,23,24)/t10-,17+/m1/s1 |
| InChIKey | XYUOOKWIMSDRCG-QGHHPUGFSA-N |
| XLogP | 2.27 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|