C24H28N2O7 — CID 3492051
3-methyl-2-[[2-[[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]acetyl]amino]pentanoic acid (PubChem CID 3492051) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is 3-methyl-2-[[2-[[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]acetyl]amino]pentanoic acid.
| Compound Name | 3-methyl-2-[[2-[[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 3492051 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 3-methyl-2-[[2-[[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]acetyl]amino]pentanoic acid |
| SMILES | CCC(C)C(NC(=O)CNC(=O)Cc1c(C)c2cc3c(C)c(C)oc3cc2oc1=O)C(=O)O |
| InChI | InChI=1S/C24H28N2O7/c1-6-11(2)22(23(29)30)26-21(28)10-25-20(27)8-17-13(4)16-7-15-12(3)14(5)32-18(15)9-19(16)33-24(17)31/h7,9,11,22H,6,8,10H2,1-5H3,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | PEBXWDNMPRUNCE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|