C25H27NO5 — CID 41062397
[4,7-dimethyl-2-oxo-3-[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]chromen-5-yl] acetate (PubChem CID 41062397) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is [4,7-dimethyl-2-oxo-3-[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]chromen-5-yl] acetate.
| Compound Name | [4,7-dimethyl-2-oxo-3-[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]chromen-5-yl] acetate |
|---|---|
| PubChem CID | 41062397 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [4,7-dimethyl-2-oxo-3-[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]chromen-5-yl] acetate |
| SMILES | CC(=O)Oc1cc(C)cc2oc(=O)c(CC(=O)N[C@H](C)CCc3ccccc3)c(C)c12 |
| InChI | InChI=1S/C25H27NO5/c1-15-12-21(30-18(4)27)24-17(3)20(25(29)31-22(24)13-15)14-23(28)26-16(2)10-11-19-8-6-5-7-9-19/h5-9,12-13,16H,10-11,14H2,1-4H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | XGUKEKIFZPZYHA-MRXNPFEDSA-N |
| XLogP | 4.02 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|