C23H25NO5 — CID 4914133
2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[2-(3-methoxyphenyl)ethyl]acetamide (PubChem CID 4914133) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[2-(3-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[2-(3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 4914133 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)-N-[2-(3-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1cccc(CCNC(=O)Cc2c(C)c3c(OC)cc(C)cc3oc2=O)c1 |
| InChI | InChI=1S/C23H25NO5/c1-14-10-19(28-4)22-15(2)18(23(26)29-20(22)11-14)13-21(25)24-9-8-16-6-5-7-17(12-16)27-3/h5-7,10-12H,8-9,13H2,1-4H3,(H,24,25) |
| InChIKey | GAWLHORATHGPTB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|