C23H24ClNO6 — CID 4914071
2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 4914071) has the molecular formula C23H24ClNO6 and a molecular weight of 445.90 g/mol. Its IUPAC name is 2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 4914071 |
| Molecular Formula | C23H24ClNO6 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1cc2oc(=O)c(CC(=O)NCCc3ccc(OC)c(OC)c3)c(C)c2cc1Cl |
| InChI | InChI=1S/C23H24ClNO6/c1-13-15-10-17(24)20(29-3)12-19(15)31-23(27)16(13)11-22(26)25-8-7-14-5-6-18(28-2)21(9-14)30-4/h5-6,9-10,12H,7-8,11H2,1-4H3,(H,25,26) |
| InChIKey | IALAXECYMQTCLM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|