C22H22ClNO6 — CID 4823564
2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 4823564) has the molecular formula C22H22ClNO6 and a molecular weight of 431.87 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 4823564 |
| Molecular Formula | C22H22ClNO6 |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)COc2cc3oc(=O)cc(C)c3cc2Cl)cc1OC |
| InChI | InChI=1S/C22H22ClNO6/c1-13-8-22(26)30-18-11-19(16(23)10-15(13)18)29-12-21(25)24-7-6-14-4-5-17(27-2)20(9-14)28-3/h4-5,8-11H,6-7,12H2,1-3H3,(H,24,25) |
| InChIKey | BWVNHNRLCKTADQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|