C20H18ClNO6 — CID 7954004
2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 7954004) has the molecular formula C20H18ClNO6 and a molecular weight of 403.82 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7954004 |
| Molecular Formula | C20H18ClNO6 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2cc3oc(=O)cc(C)c3cc2Cl)cc1OC |
| InChI | InChI=1S/C20H18ClNO6/c1-11-6-20(24)28-16-9-17(14(21)8-13(11)16)27-10-19(23)22-12-4-5-15(25-2)18(7-12)26-3/h4-9H,10H2,1-3H3,(H,22,23) |
| InChIKey | YKHGIXXOCIPBEA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|