C24H26ClNO4 — CID 41350251
2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 41350251) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 41350251 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)Nc3c(C(C)C)cccc3C(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C24H26ClNO4/c1-13(2)16-7-6-8-17(14(3)4)24(16)26-22(27)12-29-21-11-20-18(10-19(21)25)15(5)9-23(28)30-20/h6-11,13-14H,12H2,1-5H3,(H,26,27) |
| InChIKey | HIWPOZHDVSETEG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|